Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| CAS | 59-23-4 |
|---|---|
| MDL Number | MFCD00063833 |
| Molecular Formula | C6H12O6 |
Phenol, 99%, extra pure
CAS: 108-95-2 Molecular Formula: C6H6O Molecular Weight (g/mol): 94.11 MDL Number: MFCD00002143 InChI Key: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC Name: phenol SMILES: OC1=CC=CC=C1
| PubChem CID | 996 |
|---|---|
| CAS | 108-95-2 |
| Molecular Weight (g/mol) | 94.11 |
| ChEBI | CHEBI:15882 |
| MDL Number | MFCD00002143 |
| SMILES | OC1=CC=CC=C1 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| IUPAC Name | phenol |
| InChI Key | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O |
Divinylbenzene, 80%, mixture of isomers, stab. with 1000ppm 4-tert-butylcatechol
CAS: 1321-74-0 Molecular Formula: C10H10 Molecular Weight (g/mol): 130.19 MDL Number: MFCD01778656,MFCD00010654 InChI Key: MYRTYDVEIRVNKP-UHFFFAOYSA-N Synonym: divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb PubChem CID: 66666 IUPAC Name: 1,2-bis(ethenyl)benzene SMILES: C=CC1=CC=CC=C1C=C
| PubChem CID | 66666 |
|---|---|
| CAS | 1321-74-0 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD01778656,MFCD00010654 |
| SMILES | C=CC1=CC=CC=C1C=C |
| Synonym | divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb |
| IUPAC Name | 1,2-bis(ethenyl)benzene |
| InChI Key | MYRTYDVEIRVNKP-UHFFFAOYSA-N |
| Molecular Formula | C10H10 |
1,10-Phenanthroline monohydrate, ACS
CAS: 5144-89-8 Molecular Formula: C12H10N2O Molecular Weight (g/mol): 198.23 MDL Number: MFCD00149973 InChI Key: PPQJCISYYXZCAE-UHFFFAOYSA-N Synonym: 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate PubChem CID: 21226 IUPAC Name: 1,10-phenanthroline;hydrate SMILES: O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 21226 |
|---|---|
| CAS | 5144-89-8 |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Synonym | 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate |
| IUPAC Name | 1,10-phenanthroline;hydrate |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O |
L(+)-Ascorbic Acid, 99%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
1 Octane Sulfonic Acid Sodium Salt, HPLC Ion Pair Agent, Fisher Chemical™
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M IUPAC Name: sodium octane-1-sulfonate SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| CAS | 5324-84-5 |
|---|---|
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| IUPAC Name | sodium octane-1-sulfonate |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
2,2,2-Trichloroethanol, 99%
CAS: 115-20-8 Molecular Formula: C2H3Cl3O Molecular Weight (g/mol): 149.4 MDL Number: MFCD00004677 InChI Key: KPWDGTGXUYRARH-UHFFFAOYSA-N Synonym: trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol PubChem CID: 8259 ChEBI: CHEBI:28094 IUPAC Name: 2,2,2-trichloroethanol SMILES: C(C(Cl)(Cl)Cl)O
| PubChem CID | 8259 |
|---|---|
| CAS | 115-20-8 |
| Molecular Weight (g/mol) | 149.4 |
| ChEBI | CHEBI:28094 |
| MDL Number | MFCD00004677 |
| SMILES | C(C(Cl)(Cl)Cl)O |
| Synonym | trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol |
| IUPAC Name | 2,2,2-trichloroethanol |
| InChI Key | KPWDGTGXUYRARH-UHFFFAOYSA-N |
| Molecular Formula | C2H3Cl3O |
Thermo Scientific Chemicals Nicotinamide, 99%
CAS: 98-92-0 Molecular Formula: C6H6N2O Molecular Weight (g/mol): 122.13 MDL Number: MFCD00006395 InChI Key: DFPAKSUCGFBDDF-UHFFFAOYSA-N Synonym: nicotinamide,niacinamide,3-pyridinecarboxamide,vitamin pp,nicotinic acid amide,papulex,aminicotin,amixicotyn,nicobion,nicotylamide PubChem CID: 936 ChEBI: CHEBI:17154 IUPAC Name: pyridine-3-carboxamide SMILES: C1=CC(=CN=C1)C(=O)N
| PubChem CID | 936 |
|---|---|
| CAS | 98-92-0 |
| Molecular Weight (g/mol) | 122.13 |
| ChEBI | CHEBI:17154 |
| MDL Number | MFCD00006395 |
| SMILES | C1=CC(=CN=C1)C(=O)N |
| Synonym | nicotinamide,niacinamide,3-pyridinecarboxamide,vitamin pp,nicotinic acid amide,papulex,aminicotin,amixicotyn,nicobion,nicotylamide |
| IUPAC Name | pyridine-3-carboxamide |
| InChI Key | DFPAKSUCGFBDDF-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2O |
Thermo Scientific Chemicals D(+)-Xylose, 99+%
CAS: 58-86-6 Molecular Formula: C5H10O5 Molecular Weight (g/mol): 150.13
| CAS | 58-86-6 |
|---|---|
| Molecular Weight (g/mol) | 150.13 |
| Molecular Formula | C5H10O5 |
Butyl acrylate, 99+%, stabilized
CAS: 141-32-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00009446 InChI Key: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC Name: butyl prop-2-enoate SMILES: CCCCOC(=O)C=C
| PubChem CID | 8846 |
|---|---|
| CAS | 141-32-2 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:3245 |
| MDL Number | MFCD00009446 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| IUPAC Name | butyl prop-2-enoate |
| InChI Key | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Thermo Scientific Chemicals D(-)-Fructose, 99%
CAS: 57-48-7 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.16 InChI Key: BJHIKXHVCXFQLS-UYFOZJQFSA-N Synonym: d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 PubChem CID: 5984 ChEBI: CHEBI:48095 IUPAC Name: (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one SMILES: C(C(C(C(C(=O)CO)O)O)O)O
| PubChem CID | 5984 |
|---|---|
| CAS | 57-48-7 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:48095 |
| SMILES | C(C(C(C(C(=O)CO)O)O)O)O |
| Synonym | d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChI Key | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Molecular Formula | C6H12O6 |
Phenol, detached crystals, 99+%
CAS: 108-95-2 Molecular Formula: C6H6O Molecular Weight (g/mol): 94.11 MDL Number: MFCD00002143 InChI Key: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC Name: phenol SMILES: OC1=CC=CC=C1
| PubChem CID | 996 |
|---|---|
| CAS | 108-95-2 |
| Molecular Weight (g/mol) | 94.11 |
| ChEBI | CHEBI:15882 |
| MDL Number | MFCD00002143 |
| SMILES | OC1=CC=CC=C1 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| IUPAC Name | phenol |
| InChI Key | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, ACS reagent
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Propylene Glycol, MP Biomedicals
CAS: 57-55-6 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.095 InChI Key: DNIAPMSPPWPWGF-UHFFFAOYSA-N Synonym: 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost PubChem CID: 1030 ChEBI: CHEBI:16997 IUPAC Name: propane-1,2-diol SMILES: CC(CO)O
| PubChem CID | 1030 |
|---|---|
| CAS | 57-55-6 |
| Molecular Weight (g/mol) | 76.095 |
| ChEBI | CHEBI:16997 |
| SMILES | CC(CO)O |
| Synonym | 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost |
| IUPAC Name | propane-1,2-diol |
| InChI Key | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |